C19H24BNO4 — CID 42637224
[7-oxo-7-(4-phenoxyanilino)heptyl]boronic acid (PubChem CID 42637224) has the molecular formula C19H24BNO4 and a molecular weight of 341.22 g/mol. Its IUPAC name is [7-oxo-7-(4-phenoxyanilino)heptyl]boronic acid.
| Compound Name | [7-oxo-7-(4-phenoxyanilino)heptyl]boronic acid |
|---|---|
| PubChem CID | 42637224 |
| Molecular Formula | C19H24BNO4 |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | [7-oxo-7-(4-phenoxyanilino)heptyl]boronic acid |
| SMILES | O=C(CCCCCCB(O)O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24BNO4/c22-19(10-6-1-2-7-15-20(23)24)21-16-11-13-18(14-12-16)25-17-8-4-3-5-9-17/h3-5,8-9,11-14,23-24H,1-2,6-7,10,15H2,(H,21,22) |
| InChIKey | OVPNZMUYYXGNKK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|