C16H27N4O6P — CID 172539162
[4-[[(4R)-4,5-diamino-5-oxopentanoyl]amino]phenyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 172539162) has the molecular formula C16H27N4O6P and a molecular weight of 402.39 g/mol. Its IUPAC name is [4-[[(4R)-4,5-diamino-5-oxopentanoyl]amino]phenyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [4-[[(4R)-4,5-diamino-5-oxopentanoyl]amino]phenyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 172539162 |
| Molecular Formula | C16H27N4O6P |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [4-[[(4R)-4,5-diamino-5-oxopentanoyl]amino]phenyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])Oc1ccc(NC(=O)CC[C@@H](N)C(N)=O)cc1 |
| InChI | InChI=1S/C16H27N4O6P/c1-20(2,3)10-11-25-27(23,24)26-13-6-4-12(5-7-13)19-15(21)9-8-14(17)16(18)22/h4-7,14H,8-11,17H2,1-3H3,(H3-,18,19,21,22,23,24)/t14-/m1/s1 |
| InChIKey | DWLHPTXZSVPZKM-CQSZACIVSA-N |
| XLogP | -0.21 |
| TPSA | 156.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|