C19H32N3O5+ — CID 168911388
2-[2-[3-[4-[(2S)-2-amino-2-carboxyethyl]anilino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium (PubChem CID 168911388) has the molecular formula C19H32N3O5+ and a molecular weight of 382.48 g/mol. Its IUPAC name is 2-[2-[3-[4-[(2S)-2-amino-2-carboxyethyl]anilino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium.
| Compound Name | 2-[2-[3-[4-[(2S)-2-amino-2-carboxyethyl]anilino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 168911388 |
| Molecular Formula | C19H32N3O5+ |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2-[2-[3-[4-[(2S)-2-amino-2-carboxyethyl]anilino]-3-oxopropoxy]ethoxy]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOCCOCCC(=O)Nc1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C19H31N3O5/c1-22(2,3)9-11-27-13-12-26-10-8-18(23)21-16-6-4-15(5-7-16)14-17(20)19(24)25/h4-7,17H,8-14,20H2,1-3H3,(H-,21,23,24,25)/p+1/t17-/m0/s1 |
| InChIKey | ZDKWCUNDJRBTKH-KRWDZBQOSA-O |
| XLogP | 0.71 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|