C11H14N2O3U — CID 157140877
[4-[(2S)-2-amino-3-oxobutyl]phenyl]carbamic acid;uranium (PubChem CID 157140877) has the molecular formula C11H14N2O3U and a molecular weight of 460.27 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-oxobutyl]phenyl]carbamic acid;uranium.
| Compound Name | [4-[(2S)-2-amino-3-oxobutyl]phenyl]carbamic acid;uranium |
|---|---|
| PubChem CID | 157140877 |
| Molecular Formula | C11H14N2O3U |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [4-[(2S)-2-amino-3-oxobutyl]phenyl]carbamic acid;uranium |
| SMILES | CC(=O)[C@@H](N)Cc1ccc(NC(=O)O)cc1.[U] |
| InChI | InChI=1S/C11H14N2O3.U/c1-7(14)10(12)6-8-2-4-9(5-3-8)13-11(15)16;/h2-5,10,13H,6,12H2,1H3,(H,15,16);/t10-;/m0./s1 |
| InChIKey | GFVFNGGVWXUVJF-PPHPATTJSA-N |
| XLogP | 1.24 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |