C11H15NO2 — CID 115170610
[4-(2-methylpropyl)phenyl]carbamic acid (PubChem CID 115170610) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is [4-(2-methylpropyl)phenyl]carbamic acid.
| Compound Name | [4-(2-methylpropyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 115170610 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | [4-(2-methylpropyl)phenyl]carbamic acid |
| SMILES | CC(C)Cc1ccc(NC(=O)O)cc1 |
| InChI | InChI=1S/C11H15NO2/c1-8(2)7-9-3-5-10(6-4-9)12-11(13)14/h3-6,8,12H,7H2,1-2H3,(H,13,14) |
| InChIKey | DKFOWULMNPFRFJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |