C13H17NO3 — CID 115142143
methyl 2-[4-(2-methylpropyl)anilino]-2-oxoacetate (PubChem CID 115142143) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is methyl 2-[4-(2-methylpropyl)anilino]-2-oxoacetate.
| Compound Name | methyl 2-[4-(2-methylpropyl)anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 115142143 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methyl 2-[4-(2-methylpropyl)anilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C13H17NO3/c1-9(2)8-10-4-6-11(7-5-10)14-12(15)13(16)17-3/h4-7,9H,8H2,1-3H3,(H,14,15) |
| InChIKey | GOFFGIOXLJXXTO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|