C11H15NOS — CID 115169658
[4-(2-methylpropyl)phenyl]carbamothioic S-acid (PubChem CID 115169658) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is [4-(2-methylpropyl)phenyl]carbamothioic S-acid.
| Compound Name | [4-(2-methylpropyl)phenyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 115169658 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | [4-(2-methylpropyl)phenyl]carbamothioic S-acid |
| SMILES | CC(C)Cc1ccc(NC(=O)S)cc1 |
| InChI | InChI=1S/C11H15NOS/c1-8(2)7-9-3-5-10(6-4-9)12-11(13)14/h3-6,8H,7H2,1-2H3,(H2,12,13,14) |
| InChIKey | IDTYAVHZSFHPPK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|