C13H19NOS — CID 115170240
2-[4-(2-methylpropyl)phenyl]ethylcarbamothioic S-acid (PubChem CID 115170240) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-[4-(2-methylpropyl)phenyl]ethylcarbamothioic S-acid.
| Compound Name | 2-[4-(2-methylpropyl)phenyl]ethylcarbamothioic S-acid |
|---|---|
| PubChem CID | 115170240 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-[4-(2-methylpropyl)phenyl]ethylcarbamothioic S-acid |
| SMILES | CC(C)Cc1ccc(CCNC(=O)S)cc1 |
| InChI | InChI=1S/C13H19NOS/c1-10(2)9-12-5-3-11(4-6-12)7-8-14-13(15)16/h3-6,10H,7-9H2,1-2H3,(H2,14,15,16) |
| InChIKey | RMDAAAYPLQKPKB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|