C11H14ClNO — CID 115194334
N-[4-(2-methylpropyl)phenyl]carbamoyl chloride (PubChem CID 115194334) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is N-[4-(2-methylpropyl)phenyl]carbamoyl chloride.
| Compound Name | N-[4-(2-methylpropyl)phenyl]carbamoyl chloride |
|---|---|
| PubChem CID | 115194334 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-[4-(2-methylpropyl)phenyl]carbamoyl chloride |
| SMILES | CC(C)Cc1ccc(NC(=O)Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO/c1-8(2)7-9-3-5-10(6-4-9)13-11(12)14/h3-6,8H,7H2,1-2H3,(H,13,14) |
| InChIKey | UOFSKGBIQZGCIV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|