C12H17N3O3S — CID 88968357
(2S)-2-amino-3-[4-[(2-amino-3-sulfanylpropanoyl)amino]phenyl]propanoic acid (PubChem CID 88968357) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[(2-amino-3-sulfanylpropanoyl)amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[(2-amino-3-sulfanylpropanoyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 88968357 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2S)-2-amino-3-[4-[(2-amino-3-sulfanylpropanoyl)amino]phenyl]propanoic acid |
| SMILES | NC(CS)C(=O)Nc1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C12H17N3O3S/c13-9(12(17)18)5-7-1-3-8(4-2-7)15-11(16)10(14)6-19/h1-4,9-10,19H,5-6,13-14H2,(H,15,16)(H,17,18)/t9-,10?/m0/s1 |
| InChIKey | AWYGHHYADLYNRW-RGURZIINSA-N |
| XLogP | -0.16 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|