C12H17AsN2O3S — CID 173094516
2-amino-3-[4-[(2-arsanyl-3-sulfanylpropanoyl)amino]phenyl]propanoic acid (PubChem CID 173094516) has the molecular formula C12H17AsN2O3S and a molecular weight of 344.27 g/mol. Its IUPAC name is 2-amino-3-[4-[(2-arsanyl-3-sulfanylpropanoyl)amino]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[(2-arsanyl-3-sulfanylpropanoyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 173094516 |
| Molecular Formula | C12H17AsN2O3S |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-amino-3-[4-[(2-arsanyl-3-sulfanylpropanoyl)amino]phenyl]propanoic acid |
| SMILES | NC(Cc1ccc(NC(=O)C([AsH2])CS)cc1)C(=O)O |
| InChI | InChI=1S/C12H17AsN2O3S/c13-9(6-19)11(16)15-8-3-1-7(2-4-8)5-10(14)12(17)18/h1-4,9-10,19H,5-6,13-14H2,(H,15,16)(H,17,18) |
| InChIKey | VJGXMICPHZCOLC-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|