C14H19IN2O3 — CID 155319756
2-amino-3-[4-(5-iodopentanoylamino)phenyl]propanoic acid (PubChem CID 155319756) has the molecular formula C14H19IN2O3 and a molecular weight of 390.22 g/mol. Its IUPAC name is 2-amino-3-[4-(5-iodopentanoylamino)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-(5-iodopentanoylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 155319756 |
| Molecular Formula | C14H19IN2O3 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 2-amino-3-[4-(5-iodopentanoylamino)phenyl]propanoic acid |
| SMILES | NC(Cc1ccc(NC(=O)CCCCI)cc1)C(=O)O |
| InChI | InChI=1S/C14H19IN2O3/c15-8-2-1-3-13(18)17-11-6-4-10(5-7-11)9-12(16)14(19)20/h4-7,12H,1-3,8-9,16H2,(H,17,18)(H,19,20) |
| InChIKey | QRBGJGMKMXBTQU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|