C15H21ClN2O3 — CID 155319755
(2S)-2-amino-3-[3-(6-chlorohexanoylamino)phenyl]propanoic acid (PubChem CID 155319755) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-(6-chlorohexanoylamino)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[3-(6-chlorohexanoylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 155319755 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2S)-2-amino-3-[3-(6-chlorohexanoylamino)phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1cccc(NC(=O)CCCCCCl)c1)C(=O)O |
| InChI | InChI=1S/C15H21ClN2O3/c16-8-3-1-2-7-14(19)18-12-6-4-5-11(9-12)10-13(17)15(20)21/h4-6,9,13H,1-3,7-8,10,17H2,(H,18,19)(H,20,21)/t13-/m0/s1 |
| InChIKey | QONIMMVOMILAFK-ZDUSSCGKSA-N |
| XLogP | 2.38 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|