C23H30Cl2N4O2 — CID 139954692
1-(4-chlorobutyl)-3-[3-[[3-(4-chlorobutylcarbamoylamino)phenyl]methyl]phenyl]urea (PubChem CID 139954692) has the molecular formula C23H30Cl2N4O2 and a molecular weight of 465.43 g/mol. Its IUPAC name is 1-(4-chlorobutyl)-3-[3-[[3-(4-chlorobutylcarbamoylamino)phenyl]methyl]phenyl]urea.
| Compound Name | 1-(4-chlorobutyl)-3-[3-[[3-(4-chlorobutylcarbamoylamino)phenyl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 139954692 |
| Molecular Formula | C23H30Cl2N4O2 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 1-(4-chlorobutyl)-3-[3-[[3-(4-chlorobutylcarbamoylamino)phenyl]methyl]phenyl]urea |
| SMILES | O=C(NCCCCCl)Nc1cccc(Cc2cccc(NC(=O)NCCCCCl)c2)c1 |
| InChI | InChI=1S/C23H30Cl2N4O2/c24-11-1-3-13-26-22(30)28-20-9-5-7-18(16-20)15-19-8-6-10-21(17-19)29-23(31)27-14-4-2-12-25/h5-10,16-17H,1-4,11-15H2,(H2,26,28,30)(H2,27,29,31) |
| InChIKey | MNOYYHNUMQNKMK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|