C16H24ClN3O2 — CID 142971425
7-[3-(2-chloroethylcarbamoylamino)phenyl]heptanamide (PubChem CID 142971425) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 7-[3-(2-chloroethylcarbamoylamino)phenyl]heptanamide.
| Compound Name | 7-[3-(2-chloroethylcarbamoylamino)phenyl]heptanamide |
|---|---|
| PubChem CID | 142971425 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 7-[3-(2-chloroethylcarbamoylamino)phenyl]heptanamide |
| SMILES | NC(=O)CCCCCCc1cccc(NC(=O)NCCCl)c1 |
| InChI | InChI=1S/C16H24ClN3O2/c17-10-11-19-16(22)20-14-8-5-7-13(12-14)6-3-1-2-4-9-15(18)21/h5,7-8,12H,1-4,6,9-11H2,(H2,18,21)(H2,19,20,22) |
| InChIKey | UUOZCUVZJODREK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|