C13H18F3N3O — CID 115521151
1-[3-(aminomethyl)phenyl]-3-(5,5,5-trifluoropentyl)urea (PubChem CID 115521151) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-3-(5,5,5-trifluoropentyl)urea.
| Compound Name | 1-[3-(aminomethyl)phenyl]-3-(5,5,5-trifluoropentyl)urea |
|---|---|
| PubChem CID | 115521151 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-3-(5,5,5-trifluoropentyl)urea |
| SMILES | NCc1cccc(NC(=O)NCCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3N3O/c14-13(15,16)6-1-2-7-18-12(20)19-11-5-3-4-10(8-11)9-17/h3-5,8H,1-2,6-7,9,17H2,(H2,18,19,20) |
| InChIKey | PZOSGRQGGBIQQR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|