C14H19F3N2O3 — CID 110021327
1-[3-(2-hydroxyethoxy)propyl]-3-[3-(2,2,2-trifluoroethyl)phenyl]urea (PubChem CID 110021327) has the molecular formula C14H19F3N2O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is 1-[3-(2-hydroxyethoxy)propyl]-3-[3-(2,2,2-trifluoroethyl)phenyl]urea.
| Compound Name | 1-[3-(2-hydroxyethoxy)propyl]-3-[3-(2,2,2-trifluoroethyl)phenyl]urea |
|---|---|
| PubChem CID | 110021327 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[3-(2-hydroxyethoxy)propyl]-3-[3-(2,2,2-trifluoroethyl)phenyl]urea |
| SMILES | O=C(NCCCOCCO)Nc1cccc(CC(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2O3/c15-14(16,17)10-11-3-1-4-12(9-11)19-13(21)18-5-2-7-22-8-6-20/h1,3-4,9,20H,2,5-8,10H2,(H2,18,19,21) |
| InChIKey | BWSUJIHZYDNNMI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|