C13H16ClF3N2O3 — CID 110021320
1-[2-chloro-4-(trifluoromethyl)phenyl]-3-[3-(2-hydroxyethoxy)propyl]urea (PubChem CID 110021320) has the molecular formula C13H16ClF3N2O3 and a molecular weight of 340.73 g/mol. Its IUPAC name is 1-[2-chloro-4-(trifluoromethyl)phenyl]-3-[3-(2-hydroxyethoxy)propyl]urea.
| Compound Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]-3-[3-(2-hydroxyethoxy)propyl]urea |
|---|---|
| PubChem CID | 110021320 |
| Molecular Formula | C13H16ClF3N2O3 |
| Molecular Weight | 340.73 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]-3-[3-(2-hydroxyethoxy)propyl]urea |
| SMILES | O=C(NCCCOCCO)Nc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H16ClF3N2O3/c14-10-8-9(13(15,16)17)2-3-11(10)19-12(21)18-4-1-6-22-7-5-20/h2-3,8,20H,1,4-7H2,(H2,18,19,21) |
| InChIKey | CQLQJVJOQKZQON-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|