C12H11ClF3N5O — CID 75502071
1-[2-chloro-4-(trifluoromethyl)phenyl]-3-[2-(triazol-1-yl)ethyl]urea (PubChem CID 75502071) has the molecular formula C12H11ClF3N5O and a molecular weight of 333.70 g/mol. Its IUPAC name is 1-[2-chloro-4-(trifluoromethyl)phenyl]-3-[2-(triazol-1-yl)ethyl]urea.
| Compound Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]-3-[2-(triazol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 75502071 |
| Molecular Formula | C12H11ClF3N5O |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]-3-[2-(triazol-1-yl)ethyl]urea |
| SMILES | O=C(NCCn1ccnn1)Nc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H11ClF3N5O/c13-9-7-8(12(14,15)16)1-2-10(9)19-11(22)17-3-5-21-6-4-18-20-21/h1-2,4,6-7H,3,5H2,(H2,17,19,22) |
| InChIKey | PJWUXIFXNRKLLM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |