C14H17F2N5O2 — CID 72936586
1-[4-(difluoromethoxy)-2-methylphenyl]-3-[3-(triazol-1-yl)propyl]urea (PubChem CID 72936586) has the molecular formula C14H17F2N5O2 and a molecular weight of 325.32 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-2-methylphenyl]-3-[3-(triazol-1-yl)propyl]urea.
| Compound Name | 1-[4-(difluoromethoxy)-2-methylphenyl]-3-[3-(triazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 72936586 |
| Molecular Formula | C14H17F2N5O2 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-[4-(difluoromethoxy)-2-methylphenyl]-3-[3-(triazol-1-yl)propyl]urea |
| SMILES | Cc1cc(OC(F)F)ccc1NC(=O)NCCCn1ccnn1 |
| InChI | InChI=1S/C14H17F2N5O2/c1-10-9-11(23-13(15)16)3-4-12(10)19-14(22)17-5-2-7-21-8-6-18-20-21/h3-4,6,8-9,13H,2,5,7H2,1H3,(H2,17,19,22) |
| InChIKey | WORWUZSDUOXWGK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|