C13H13F2N3O2 — CID 19475661
N-[4-(difluoromethoxy)-2-methylphenyl]-2-methylpyrazole-3-carboxamide (PubChem CID 19475661) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-2-methylphenyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)-2-methylphenyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19475661 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[4-(difluoromethoxy)-2-methylphenyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(OC(F)F)ccc1NC(=O)c1ccnn1C |
| InChI | InChI=1S/C13H13F2N3O2/c1-8-7-9(20-13(14)15)3-4-10(8)17-12(19)11-5-6-16-18(11)2/h3-7,13H,1-2H3,(H,17,19) |
| InChIKey | AVCVXLBHPSEPLI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |