C12H9F2N3O3 — CID 60829589
2,4-difluoro-5-[(2-methylpyrazole-3-carbonyl)amino]benzoic acid (PubChem CID 60829589) has the molecular formula C12H9F2N3O3 and a molecular weight of 281.22 g/mol. Its IUPAC name is 2,4-difluoro-5-[(2-methylpyrazole-3-carbonyl)amino]benzoic acid.
| Compound Name | 2,4-difluoro-5-[(2-methylpyrazole-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 60829589 |
| Molecular Formula | C12H9F2N3O3 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2,4-difluoro-5-[(2-methylpyrazole-3-carbonyl)amino]benzoic acid |
| SMILES | Cn1nccc1C(=O)Nc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C12H9F2N3O3/c1-17-10(2-3-15-17)11(18)16-9-4-6(12(19)20)7(13)5-8(9)14/h2-5H,1H3,(H,16,18)(H,19,20) |
| InChIKey | YLLODGNRXTZVPB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |