C10H9N3O3S — CID 43664804
2-[(2-methylpyrazole-3-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 43664804) has the molecular formula C10H9N3O3S and a molecular weight of 251.27 g/mol. Its IUPAC name is 2-[(2-methylpyrazole-3-carbonyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[(2-methylpyrazole-3-carbonyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 43664804 |
| Molecular Formula | C10H9N3O3S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-[(2-methylpyrazole-3-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | Cn1nccc1C(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C10H9N3O3S/c1-13-7(2-4-11-13)8(14)12-9-6(10(15)16)3-5-17-9/h2-5H,1H3,(H,12,14)(H,15,16) |
| InChIKey | FSSUIEPSKZTUFE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |