C11H8N2O4S — CID 114040056
2-[(6-oxo-1H-pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 114040056) has the molecular formula C11H8N2O4S and a molecular weight of 264.26 g/mol. Its IUPAC name is 2-[(6-oxo-1H-pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[(6-oxo-1H-pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 114040056 |
| Molecular Formula | C11H8N2O4S |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2-[(6-oxo-1H-pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1sccc1C(=O)O)c1cccc(=O)[nH]1 |
| InChI | InChI=1S/C11H8N2O4S/c14-8-3-1-2-7(12-8)9(15)13-10-6(11(16)17)4-5-18-10/h1-5H,(H,12,14)(H,13,15)(H,16,17) |
| InChIKey | HQDQRMYJSAWFTM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |