C11H9F2N3O — CID 110467115
N-(2,6-difluorophenyl)-2-methylpyrazole-3-carboxamide (PubChem CID 110467115) has the molecular formula C11H9F2N3O and a molecular weight of 237.21 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-methylpyrazole-3-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110467115 |
| Molecular Formula | C11H9F2N3O |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C11H9F2N3O/c1-16-9(5-6-14-16)11(17)15-10-7(12)3-2-4-8(10)13/h2-6H,1H3,(H,15,17) |
| InChIKey | PFMCTLDZZRSTCZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |