C11H11ClN4O — CID 55130611
N-(2-amino-6-chlorophenyl)-2-methylpyrazole-3-carboxamide (PubChem CID 55130611) has the molecular formula C11H11ClN4O and a molecular weight of 250.69 g/mol. Its IUPAC name is N-(2-amino-6-chlorophenyl)-2-methylpyrazole-3-carboxamide.
| Compound Name | N-(2-amino-6-chlorophenyl)-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55130611 |
| Molecular Formula | C11H11ClN4O |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | N-(2-amino-6-chlorophenyl)-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)Nc1c(N)cccc1Cl |
| InChI | InChI=1S/C11H11ClN4O/c1-16-9(5-6-14-16)11(17)15-10-7(12)3-2-4-8(10)13/h2-6H,13H2,1H3,(H,15,17) |
| InChIKey | SOZVJFFUEUMOKZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|