C11H10Cl2N4O — CID 114051088
N-(2,6-dichloro-4-methyl-3-pyridinyl)-2-methylpyrazole-3-carboxamide (PubChem CID 114051088) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is N-(2,6-dichloro-4-methyl-3-pyridinyl)-2-methylpyrazole-3-carboxamide.
| Compound Name | N-(2,6-dichloro-4-methyl-3-pyridinyl)-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 114051088 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | N-(2,6-dichloro-4-methyl-3-pyridinyl)-2-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(Cl)nc(Cl)c1NC(=O)c1ccnn1C |
| InChI | InChI=1S/C11H10Cl2N4O/c1-6-5-8(12)15-10(13)9(6)16-11(18)7-3-4-14-17(7)2/h3-5H,1-2H3,(H,16,18) |
| InChIKey | BVODCOWSFRJNON-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|