C11H9Cl2N3O2 — CID 114051086
N-(2,6-dichloro-4-methyl-3-pyridinyl)-4-methyl-1,2-oxazole-5-carboxamide (PubChem CID 114051086) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is N-(2,6-dichloro-4-methyl-3-pyridinyl)-4-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(2,6-dichloro-4-methyl-3-pyridinyl)-4-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 114051086 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | N-(2,6-dichloro-4-methyl-3-pyridinyl)-4-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cnoc1C(=O)Nc1c(C)cc(Cl)nc1Cl |
| InChI | InChI=1S/C11H9Cl2N3O2/c1-5-3-7(12)15-10(13)8(5)16-11(17)9-6(2)4-14-18-9/h3-4H,1-2H3,(H,16,17) |
| InChIKey | GZGKCWMVWCERSF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|