C11H7BrCl2N2OS — CID 103738307
3-bromo-N-(2,6-dichloro-4-methyl-3-pyridinyl)thiophene-2-carboxamide (PubChem CID 103738307) has the molecular formula C11H7BrCl2N2OS and a molecular weight of 366.07 g/mol. Its IUPAC name is 3-bromo-N-(2,6-dichloro-4-methyl-3-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-(2,6-dichloro-4-methyl-3-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103738307 |
| Molecular Formula | C11H7BrCl2N2OS |
| Molecular Weight | 366.07 g/mol |
| Exact Mass | 363.88 |
| IUPAC Name | 3-bromo-N-(2,6-dichloro-4-methyl-3-pyridinyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(Cl)nc(Cl)c1NC(=O)c1sccc1Br |
| InChI | InChI=1S/C11H7BrCl2N2OS/c1-5-4-7(13)15-10(14)8(5)16-11(17)9-6(12)2-3-18-9/h2-4H,1H3,(H,16,17) |
| InChIKey | UXQXDZFKXLPFFD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.07 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|