C11H9BrCl2N2S — CID 114051280
N-[(3-bromothiophen-2-yl)methyl]-2,6-dichloro-4-methylpyridin-3-amine (PubChem CID 114051280) has the molecular formula C11H9BrCl2N2S and a molecular weight of 352.08 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-2,6-dichloro-4-methylpyridin-3-amine.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-2,6-dichloro-4-methylpyridin-3-amine |
|---|---|
| PubChem CID | 114051280 |
| Molecular Formula | C11H9BrCl2N2S |
| Molecular Weight | 352.08 g/mol |
| Exact Mass | 349.90 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-2,6-dichloro-4-methylpyridin-3-amine |
| SMILES | Cc1cc(Cl)nc(Cl)c1NCc1sccc1Br |
| InChI | InChI=1S/C11H9BrCl2N2S/c1-6-4-9(13)16-11(14)10(6)15-5-8-7(12)2-3-17-8/h2-4,15H,5H2,1H3 |
| InChIKey | AEZZRIVOXXFZLM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.08 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|