C11H12BrN3S — CID 114476013
N-[(3-bromothiophen-2-yl)methyl]-5,6-dimethylpyrazin-2-amine (PubChem CID 114476013) has the molecular formula C11H12BrN3S and a molecular weight of 298.21 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-5,6-dimethylpyrazin-2-amine.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-5,6-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 114476013 |
| Molecular Formula | C11H12BrN3S |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-5,6-dimethylpyrazin-2-amine |
| SMILES | Cc1ncc(NCc2sccc2Br)nc1C |
| InChI | InChI=1S/C11H12BrN3S/c1-7-8(2)15-11(6-13-7)14-5-10-9(12)3-4-16-10/h3-4,6H,5H2,1-2H3,(H,14,15) |
| InChIKey | NFZPCXOUNCBIEM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |