C11H15Cl2N3O — CID 114051353
N-(2,6-dichloro-4-methyl-3-pyridinyl)-2-methyl-2-(methylamino)propanamide (PubChem CID 114051353) has the molecular formula C11H15Cl2N3O and a molecular weight of 276.17 g/mol. Its IUPAC name is N-(2,6-dichloro-4-methyl-3-pyridinyl)-2-methyl-2-(methylamino)propanamide.
| Compound Name | N-(2,6-dichloro-4-methyl-3-pyridinyl)-2-methyl-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 114051353 |
| Molecular Formula | C11H15Cl2N3O |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-(2,6-dichloro-4-methyl-3-pyridinyl)-2-methyl-2-(methylamino)propanamide |
| SMILES | CNC(C)(C)C(=O)Nc1c(C)cc(Cl)nc1Cl |
| InChI | InChI=1S/C11H15Cl2N3O/c1-6-5-7(12)15-9(13)8(6)16-10(17)11(2,3)14-4/h5,14H,1-4H3,(H,16,17) |
| InChIKey | STPAMZWWTKELBZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|