C9H10Cl2N2O4S — CID 114051258
3-[(2,6-dichloro-4-methyl-3-pyridinyl)sulfamoyl]propanoic acid (PubChem CID 114051258) has the molecular formula C9H10Cl2N2O4S and a molecular weight of 313.16 g/mol. Its IUPAC name is 3-[(2,6-dichloro-4-methyl-3-pyridinyl)sulfamoyl]propanoic acid.
| Compound Name | 3-[(2,6-dichloro-4-methyl-3-pyridinyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 114051258 |
| Molecular Formula | C9H10Cl2N2O4S |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | 3-[(2,6-dichloro-4-methyl-3-pyridinyl)sulfamoyl]propanoic acid |
| SMILES | Cc1cc(Cl)nc(Cl)c1NS(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C9H10Cl2N2O4S/c1-5-4-6(10)12-9(11)8(5)13-18(16,17)3-2-7(14)15/h4,13H,2-3H2,1H3,(H,14,15) |
| InChIKey | QGBZPHJTQIYILP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|