2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid

C7H6Cl2N2O2 — CID 122198422

IUPAC2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid
SMILESCNc1c(C(=O)O)cc(Cl)nc1Cl
InChIInChI=1S/C7H6Cl2N2O2/c1-10-5-3(7(12)13)2-4(8)11-6(5)9/h2,10H,1H3,(H,12,13)
InChIKeyXWAYOLUNDGFJDS-UHFFFAOYSA-N
MW221.04 g/mol
LogP2.13
Rot. Bonds2

About 2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid

2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid (PubChem CID 122198422) has the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. Its IUPAC name is 2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid.

Molecular Properties

Compound Name2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid
PubChem CID122198422
Molecular FormulaC7H6Cl2N2O2
Molecular Weight221.04 g/mol
Exact Mass219.98
IUPAC Name2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid
SMILESCNc1c(C(=O)O)cc(Cl)nc1Cl
InChIInChI=1S/C7H6Cl2N2O2/c1-10-5-3(7(12)13)2-4(8)11-6(5)9/h2,10H,1H3,(H,12,13)
InChIKeyXWAYOLUNDGFJDS-UHFFFAOYSA-N
XLogP2.13
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.04
LogP ≤ 52.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid?
The IUPAC name of 2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid (CID 122198422) is 2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid.
What is the SMILES notation for 2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid?
The canonical SMILES for 2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid is CNc1c(C(=O)O)cc(Cl)nc1Cl.
What is the InChIKey of 2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid?
The InChIKey is XWAYOLUNDGFJDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2N2O2/c1-10-5-3(7(12)13)2-4(8)11-6(5)9/h2,10H,1H3,(H,12,13).
What are the key properties of 2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid?
2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid has a molecular weight of 221.04 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-3-(methylamino)pyridine-4-carboxylic acid is sourced from PubChem (CID 122198422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).