About 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid
5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid (PubChem CID 53399605) has the molecular formula C8H4Cl2N2O2
and a molecular weight of 231.04 g/mol. Its IUPAC name is 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid |
| PubChem CID | 53399605 |
| Molecular Formula | C8H4Cl2N2O2 |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2c(Cl)nc(Cl)cc12 |
| InChI | InChI=1S/C8H4Cl2N2O2/c9-5-1-3-4(8(13)14)2-11-6(3)7(10)12-5/h1-2,11H,(H,13,14) |
| InChIKey | MIRVXHZGFGMQAA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid?
The IUPAC name of 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid (CID 53399605) is 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid.
What is the SMILES notation for 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid?
The canonical SMILES for 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid is O=C(O)c1c[nH]c2c(Cl)nc(Cl)cc12.
What is the InChIKey of 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid?
The InChIKey is MIRVXHZGFGMQAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2N2O2/c9-5-1-3-4(8(13)14)2-11-6(3)7(10)12-5/h1-2,11H,(H,13,14).
What are the key properties of 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid?
5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid has a molecular weight of 231.04 g/mol, XLogP of 2.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid is sourced from PubChem (CID 53399605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).