About CID 87288277
CID 87288277 (PubChem CID 87288277) has the molecular formula C9H5ClKN2O3
and a molecular weight of 263.70 g/mol.
Molecular Properties
| Compound Name | CID 87288277 |
| PubChem CID | 87288277 |
| Molecular Formula | C9H5ClKN2O3 |
| Molecular Weight | 263.70 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | — |
| SMILES | O=C(O)C(=O)c1c[nH]c2c(Cl)nccc12.[K] |
| InChI | InChI=1S/C9H5ClN2O3.K/c10-8-6-4(1-2-11-8)5(3-12-6)7(13)9(14)15;/h1-3,12H,(H,14,15); |
| InChIKey | HJIUVUCSHPBFSJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.70 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze CID 87288277 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87288277?
The IUPAC name of CID 87288277 (CID 87288277) is not available.
What is the SMILES notation for CID 87288277?
The canonical SMILES for CID 87288277 is O=C(O)C(=O)c1c[nH]c2c(Cl)nccc12.[K].
What is the InChIKey of CID 87288277?
The InChIKey is HJIUVUCSHPBFSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN2O3.K/c10-8-6-4(1-2-11-8)5(3-12-6)7(13)9(14)15;/h1-3,12H,(H,14,15);.
What are the key properties of CID 87288277?
CID 87288277 has a molecular weight of 263.70 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87288277 is sourced from PubChem (CID 87288277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).