C10H7BrN2O3 — CID 87288420
methyl 2-(7-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-oxoacetate (PubChem CID 87288420) has the molecular formula C10H7BrN2O3 and a molecular weight of 283.08 g/mol. Its IUPAC name is methyl 2-(7-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-oxoacetate.
| Compound Name | methyl 2-(7-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 87288420 |
| Molecular Formula | C10H7BrN2O3 |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | methyl 2-(7-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1c[nH]c2c(Br)nccc12 |
| InChI | InChI=1S/C10H7BrN2O3/c1-16-10(15)8(14)6-4-13-7-5(6)2-3-12-9(7)11/h2-4,13H,1H3 |
| InChIKey | SPQHIOXEOJVQQS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|