C7H4Cl2N2 — CID 53412470
3,7-dichloro-1H-pyrrolo[2,3-c]pyridine (PubChem CID 53412470) has the molecular formula C7H4Cl2N2 and a molecular weight of 187.03 g/mol. Its IUPAC name is 3,7-dichloro-1H-pyrrolo[2,3-c]pyridine.
| Compound Name | 3,7-dichloro-1H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 53412470 |
| Molecular Formula | C7H4Cl2N2 |
| Molecular Weight | 187.03 g/mol |
| Exact Mass | 185.98 |
| IUPAC Name | 3,7-dichloro-1H-pyrrolo[2,3-c]pyridine |
| SMILES | Clc1c[nH]c2c(Cl)nccc12 |
| InChI | InChI=1S/C7H4Cl2N2/c8-5-3-11-6-4(5)1-2-10-7(6)9/h1-3,11H |
| InChIKey | YBHYTJOZUHOPTG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.03 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|