C8H5Cl2F3N2O3 — CID 132579428
methyl N-[2,6-dichloro-4-(trifluoromethoxy)-3-pyridinyl]carbamate (PubChem CID 132579428) has the molecular formula C8H5Cl2F3N2O3 and a molecular weight of 305.04 g/mol. Its IUPAC name is methyl N-[2,6-dichloro-4-(trifluoromethoxy)-3-pyridinyl]carbamate.
| Compound Name | methyl N-[2,6-dichloro-4-(trifluoromethoxy)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 132579428 |
| Molecular Formula | C8H5Cl2F3N2O3 |
| Molecular Weight | 305.04 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | methyl N-[2,6-dichloro-4-(trifluoromethoxy)-3-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1c(OC(F)(F)F)cc(Cl)nc1Cl |
| InChI | InChI=1S/C8H5Cl2F3N2O3/c1-17-7(16)15-5-3(18-8(11,12)13)2-4(9)14-6(5)10/h2H,1H3,(H,15,16) |
| InChIKey | SUEIVKPWZQAPAN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.04 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|