C10H9Cl2N3O2S — CID 114051197
N-(2,6-dichloro-4-methyl-3-pyridinyl)-1H-pyrrole-3-sulfonamide (PubChem CID 114051197) has the molecular formula C10H9Cl2N3O2S and a molecular weight of 306.17 g/mol. Its IUPAC name is N-(2,6-dichloro-4-methyl-3-pyridinyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(2,6-dichloro-4-methyl-3-pyridinyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 114051197 |
| Molecular Formula | C10H9Cl2N3O2S |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | N-(2,6-dichloro-4-methyl-3-pyridinyl)-1H-pyrrole-3-sulfonamide |
| SMILES | Cc1cc(Cl)nc(Cl)c1NS(=O)(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C10H9Cl2N3O2S/c1-6-4-8(11)14-10(12)9(6)15-18(16,17)7-2-3-13-5-7/h2-5,13,15H,1H3 |
| InChIKey | YSOFWRAWPUWLJI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|