C12H9ClN2O4 — CID 66334329
4-chloro-2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]benzoic acid (PubChem CID 66334329) has the molecular formula C12H9ClN2O4 and a molecular weight of 280.67 g/mol. Its IUPAC name is 4-chloro-2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]benzoic acid.
| Compound Name | 4-chloro-2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 66334329 |
| Molecular Formula | C12H9ClN2O4 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 4-chloro-2-[(4-methyl-1,2-oxazole-5-carbonyl)amino]benzoic acid |
| SMILES | Cc1cnoc1C(=O)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C12H9ClN2O4/c1-6-5-14-19-10(6)11(16)15-9-4-7(13)2-3-8(9)12(17)18/h2-5H,1H3,(H,15,16)(H,17,18) |
| InChIKey | NILRNWMWPYCMMJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |