C12H10N2O5 — CID 66336599
3-hydroxy-4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]benzoic acid (PubChem CID 66336599) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 3-hydroxy-4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]benzoic acid.
| Compound Name | 3-hydroxy-4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 66336599 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 3-hydroxy-4-[(4-methyl-1,2-oxazole-5-carbonyl)amino]benzoic acid |
| SMILES | Cc1cnoc1C(=O)Nc1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C12H10N2O5/c1-6-5-13-19-10(6)11(16)14-8-3-2-7(12(17)18)4-9(8)15/h2-5,15H,1H3,(H,14,16)(H,17,18) |
| InChIKey | CVQXUSLFJFSXIJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|