C10H7F2N3O2 — CID 103098068
N-(2,6-difluoro-3-pyridinyl)-4-methyl-1,2-oxazole-5-carboxamide (PubChem CID 103098068) has the molecular formula C10H7F2N3O2 and a molecular weight of 239.18 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-4-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-4-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 103098068 |
| Molecular Formula | C10H7F2N3O2 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-4-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cnoc1C(=O)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C10H7F2N3O2/c1-5-4-13-17-8(5)10(16)14-6-2-3-7(11)15-9(6)12/h2-4H,1H3,(H,14,16) |
| InChIKey | HFIGCGSVJOVNCK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|