C14H15F3N4O — CID 91775896
2-methyl-N-[3-(triazol-1-yl)propyl]-5-(trifluoromethyl)benzamide (PubChem CID 91775896) has the molecular formula C14H15F3N4O and a molecular weight of 312.30 g/mol. Its IUPAC name is 2-methyl-N-[3-(triazol-1-yl)propyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-methyl-N-[3-(triazol-1-yl)propyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91775896 |
| Molecular Formula | C14H15F3N4O |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-methyl-N-[3-(triazol-1-yl)propyl]-5-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(C(F)(F)F)cc1C(=O)NCCCn1ccnn1 |
| InChI | InChI=1S/C14H15F3N4O/c1-10-3-4-11(14(15,16)17)9-12(10)13(22)18-5-2-7-21-8-6-19-20-21/h3-4,6,8-9H,2,5,7H2,1H3,(H,18,22) |
| InChIKey | JZCBBRXOJNRDPV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|