C14H19N5O3S — CID 135103024
4-(ethylsulfonylamino)-N-[3-(triazol-1-yl)propyl]benzamide (PubChem CID 135103024) has the molecular formula C14H19N5O3S and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-(ethylsulfonylamino)-N-[3-(triazol-1-yl)propyl]benzamide.
| Compound Name | 4-(ethylsulfonylamino)-N-[3-(triazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 135103024 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-(ethylsulfonylamino)-N-[3-(triazol-1-yl)propyl]benzamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C(=O)NCCCn2ccnn2)cc1 |
| InChI | InChI=1S/C14H19N5O3S/c1-2-23(21,22)17-13-6-4-12(5-7-13)14(20)15-8-3-10-19-11-9-16-18-19/h4-7,9,11,17H,2-3,8,10H2,1H3,(H,15,20) |
| InChIKey | WRDGJISAWHVIFZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|