C13H17N5O3 — CID 91768013
2,6-dimethoxy-N-[3-(triazol-1-yl)propyl]pyridine-3-carboxamide (PubChem CID 91768013) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[3-(triazol-1-yl)propyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dimethoxy-N-[3-(triazol-1-yl)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91768013 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2,6-dimethoxy-N-[3-(triazol-1-yl)propyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)NCCCn2ccnn2)c(OC)n1 |
| InChI | InChI=1S/C13H17N5O3/c1-20-11-5-4-10(13(16-11)21-2)12(19)14-6-3-8-18-9-7-15-17-18/h4-5,7,9H,3,6,8H2,1-2H3,(H,14,19) |
| InChIKey | UKCNJHCMPFSBIL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|