C18H24N4O2 — CID 118769650
1-(4-methoxyphenyl)-2,2-dimethyl-N-[3-(triazol-1-yl)propyl]cyclopropane-1-carboxamide (PubChem CID 118769650) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,2-dimethyl-N-[3-(triazol-1-yl)propyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-2,2-dimethyl-N-[3-(triazol-1-yl)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 118769650 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,2-dimethyl-N-[3-(triazol-1-yl)propyl]cyclopropane-1-carboxamide |
| SMILES | COc1ccc(C2(C(=O)NCCCn3ccnn3)CC2(C)C)cc1 |
| InChI | InChI=1S/C18H24N4O2/c1-17(2)13-18(17,14-5-7-15(24-3)8-6-14)16(23)19-9-4-11-22-12-10-20-21-22/h5-8,10,12H,4,9,11,13H2,1-3H3,(H,19,23) |
| InChIKey | GWSIZCODWSDXEJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|