C16H20N4O3 — CID 97134116
(3S)-7-methoxy-N-[3-(triazol-1-yl)propyl]-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 97134116) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is (3S)-7-methoxy-N-[3-(triazol-1-yl)propyl]-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3S)-7-methoxy-N-[3-(triazol-1-yl)propyl]-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 97134116 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (3S)-7-methoxy-N-[3-(triazol-1-yl)propyl]-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | COc1ccc2c(c1)OC[C@@H](C(=O)NCCCn1ccnn1)C2 |
| InChI | InChI=1S/C16H20N4O3/c1-22-14-4-3-12-9-13(11-23-15(12)10-14)16(21)17-5-2-7-20-8-6-18-19-20/h3-4,6,8,10,13H,2,5,7,9,11H2,1H3,(H,17,21)/t13-/m0/s1 |
| InChIKey | FLZBMGJPPZRKGU-ZDUSSCGKSA-N |
| XLogP | 1.04 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|