C19H28N2O3 — CID 22578278
6-methoxy-N-(3-piperidin-1-ylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 22578278) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 6-methoxy-N-(3-piperidin-1-ylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | 6-methoxy-N-(3-piperidin-1-ylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 22578278 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 6-methoxy-N-(3-piperidin-1-ylpropyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | COc1ccc2c(c1)CC(C(=O)NCCCN1CCCCC1)CO2 |
| InChI | InChI=1S/C19H28N2O3/c1-23-17-6-7-18-15(13-17)12-16(14-24-18)19(22)20-8-5-11-21-9-3-2-4-10-21/h6-7,13,16H,2-5,8-12,14H2,1H3,(H,20,22) |
| InChIKey | SZBSQUAXDCFJPQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|