C24H33NO4 — CID 92713321
(3S)-N-[3-(1-adamantyloxy)propyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 92713321) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is (3S)-N-[3-(1-adamantyloxy)propyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3S)-N-[3-(1-adamantyloxy)propyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 92713321 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | (3S)-N-[3-(1-adamantyloxy)propyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | COc1ccc2c(c1)C[C@H](C(=O)NCCCOC13CC4CC(CC(C4)C1)C3)CO2 |
| InChI | InChI=1S/C24H33NO4/c1-27-21-3-4-22-19(11-21)10-20(15-28-22)23(26)25-5-2-6-29-24-12-16-7-17(13-24)9-18(8-16)14-24/h3-4,11,16-18,20H,2,5-10,12-15H2,1H3,(H,25,26)/t16?,17?,18?,20-,24?/m0/s1 |
| InChIKey | DDBIUROGPZSAFX-BSFBHTCNSA-N |
| XLogP | 3.74 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|